CAS 179062-00-1 appears in our catalog under these names: 2-Acetamido-5-bromo-3-nitrobenzotrifluoride, 96%, N-(4-Bromo-2-nitro-6-(trifluoromethyl)phenyl)acetamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg.
N-[4-bromo-2-nitro-6-(trifluoromethyl)phenyl]acetamide (CAS 179062-00-1) is a chemical compound with the molecular formula C9H6BrF3N2O3 and a molecular weight of 327.05 g/mol. IUPAC name: N-[4-bromo-2-nitro-6-(trifluoromethyl)phenyl]acetamide. InChIKey: BBTWQPVLHGAKHG-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3N2O3 |
|---|---|
| Molecular weight | 327.05 g/mol |
| IUPAC name | N-[4-bromo-2-nitro-6-(trifluoromethyl)phenyl]acetamide |
| InChIKey | BBTWQPVLHGAKHG-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1[N+](=O)[O-])Br)C(F)(F)F |
Computed by PubChem (NCBI)