Products 179068-64-5
CAS 179068-64-5 is the registry number for NC-2100. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(7-phenylmethoxyquinolin-3-yl)methyl]-1,3-thiazolidine-2,4-dione (CAS 179068-64-5) is a chemical compound with the molecular formula C20H16N2O3S and a molecular weight of 364.4 g/mol. IUPAC name: 5-[(7-phenylmethoxyquinolin-3-yl)methyl]-1,3-thiazolidine-2,4-dione. InChIKey: AZKFGOQRYCSQPK-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O3S |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 5-[(7-phenylmethoxyquinolin-3-yl)methyl]-1,3-thiazolidine-2,4-dione |
| InChIKey | AZKFGOQRYCSQPK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=NC=C(C=C3C=C2)CC4C(=O)NC(=O)S4 |
Computed by PubChem (NCBI)