CAS 179111-05-8 is the registry number for 3-Bromo-6-fluorochromone, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
3-bromo-6-fluorochromen-4-one (CAS 179111-05-8) is a chemical compound with the molecular formula C9H4BrFO2 and a molecular weight of 243.03 g/mol. IUPAC name: 3-bromo-6-fluorochromen-4-one. InChIKey: KASZNDJKYQAXNZ-UHFFFAOYSA-N.
| Molecular formula | C9H4BrFO2 |
|---|---|
| Molecular weight | 243.03 g/mol |
| IUPAC name | 3-bromo-6-fluorochromen-4-one |
| InChIKey | KASZNDJKYQAXNZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=O)C(=CO2)Br |
Computed by PubChem (NCBI)