CAS 179113-74-7 is the registry number for 7-Bromo-2-oxo-2H-chromen-4-yl trifluoromethanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(7-bromo-2-oxochromen-4-yl) trifluoromethanesulfonate (CAS 179113-74-7) is a chemical compound with the molecular formula C10H4BrF3O5S and a molecular weight of 373.10 g/mol. IUPAC name: (7-bromo-2-oxochromen-4-yl) trifluoromethanesulfonate. InChIKey: NJWODPRGXMVZBA-UHFFFAOYSA-N.
| Molecular formula | C10H4BrF3O5S |
|---|---|
| Molecular weight | 373.10 g/mol |
| IUPAC name | (7-bromo-2-oxochromen-4-yl) trifluoromethanesulfonate |
| InChIKey | NJWODPRGXMVZBA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)OC(=O)C=C2OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)