Products 179128-86-0

CAS 179128-86-0 is the registry number for 3-(3,4-Bis(benzyloxy)phenyl)-2-hydroxypropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[3,4-bis(phenylmethoxy)phenyl]-2-hydroxypropanoic acid (CAS 179128-86-0) is a chemical compound with the molecular formula C23H22O5 and a molecular weight of 378.4 g/mol. IUPAC name: 3-[3,4-bis(phenylmethoxy)phenyl]-2-hydroxypropanoic acid. InChIKey: JLQBQSZIXGRWKY-UHFFFAOYSA-N.

Identity
Molecular formulaC23H22O5
Molecular weight378.4 g/mol
IUPAC name3-[3,4-bis(phenylmethoxy)phenyl]-2-hydroxypropanoic acid
InChIKeyJLQBQSZIXGRWKY-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=C(C=C(C=C2)CC(C(=O)O)O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)