CAS 179174-79-9 appears in our catalog under these names: (Z)-4-Acetoxy-3-(4-(methylsulfonyl) phenyl)-2-phenylbut-2-enoic acid, 95%, (Z)-4-Acetoxy-3-(4-(methylsulfonyl) phenyl)-2-phenylbut-2-enoic acid, 97%, (Z)–4–Acetoxy–3–(4–(methylsulfonyl) phenyl)–2–phenylbut–2–enoic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoic acid (CAS 179174-79-9) is a chemical compound with the molecular formula C19H18O6S and a molecular weight of 374.4 g/mol. IUPAC name: (Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoic acid. InChIKey: RPWJWEFMAVOUBY-ISLYRVAYSA-N.
| Molecular formula | C19H18O6S |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | (Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoic acid |
| InChIKey | RPWJWEFMAVOUBY-ISLYRVAYSA-N |
| SMILES | CC(=O)OC/C(=C(/C1=CC=CC=C1)\C(=O)O)/C2=CC=C(C=C2)S(=O)(=O)C |
Computed by PubChem (NCBI)