CAS 179175-15-6 is the registry number for 5-Keto Vioxx. Offered by: TRC. Available pack sizes: 10mg, 1mg.
3-(4-methylsulfonylphenyl)-4-phenylfuran-2,5-dione (CAS 179175-15-6) is a chemical compound with the molecular formula C17H12O5S and a molecular weight of 328.3 g/mol. IUPAC name: 3-(4-methylsulfonylphenyl)-4-phenylfuran-2,5-dione. InChIKey: LJZJWBAPABMSII-UHFFFAOYSA-N.
| Molecular formula | C17H12O5S |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | 3-(4-methylsulfonylphenyl)-4-phenylfuran-2,5-dione |
| InChIKey | LJZJWBAPABMSII-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C2=C(C(=O)OC2=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)