CAS 179178-91-7 is the registry number for 4,5,7–Trifluorobenzo(d)thiazole–2(3H)–thione. Offered by: GLPBio. Available pack sizes: 250mg.
4,5,7-trifluoro-3H-1,3-benzothiazole-2-thione (CAS 179178-91-7) is a chemical compound with the molecular formula C7H2F3NS2 and a molecular weight of 221.2 g/mol. IUPAC name: 4,5,7-trifluoro-3H-1,3-benzothiazole-2-thione. InChIKey: HUMAIXYGXLTLPV-UHFFFAOYSA-N.
| Molecular formula | C7H2F3NS2 |
|---|---|
| Molecular weight | 221.2 g/mol |
| IUPAC name | 4,5,7-trifluoro-3H-1,3-benzothiazole-2-thione |
| InChIKey | HUMAIXYGXLTLPV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C2C(=C1F)SC(=S)N2)F)F |
Computed by PubChem (NCBI)