Products 17922-79-1

CAS 17922-79-1 is the registry number for N-Cyclohexyl L-Z-Valinamide, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[(2S)-1-(cyclohexylamino)-3-methyl-1-oxobutan-2-yl]carbamate (CAS 17922-79-1) is a chemical compound with the molecular formula C19H28N2O3 and a molecular weight of 332.4 g/mol. IUPAC name: benzyl N-[(2S)-1-(cyclohexylamino)-3-methyl-1-oxobutan-2-yl]carbamate. InChIKey: UQBYHYLSJXPFLH-KRWDZBQOSA-N.

Identity
Molecular formulaC19H28N2O3
Molecular weight332.4 g/mol
IUPAC namebenzyl N-[(2S)-1-(cyclohexylamino)-3-methyl-1-oxobutan-2-yl]carbamate
InChIKeyUQBYHYLSJXPFLH-KRWDZBQOSA-N
SMILESCC(C)[C@@H](C(=O)NC1CCCCC1)NC(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)