CAS 179247-04-2 is the registry number for N4-(4-(Benzyloxy)phenyl)quinazoline-4,6-diamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-N-(4-phenylmethoxyphenyl)quinazoline-4,6-diamine (CAS 179247-04-2) is a chemical compound with the molecular formula C21H18N4O and a molecular weight of 342.4 g/mol. IUPAC name: 4-N-(4-phenylmethoxyphenyl)quinazoline-4,6-diamine. InChIKey: NYWGNYMXJNJUEU-UHFFFAOYSA-N.
| Molecular formula | C21H18N4O |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 4-N-(4-phenylmethoxyphenyl)quinazoline-4,6-diamine |
| InChIKey | NYWGNYMXJNJUEU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)NC3=NC=NC4=C3C=C(C=C4)N |
Computed by PubChem (NCBI)