CAS 17925-90-5 appears in our catalog under these names: Dacarbazine hydrochloride, Dacarbazine (hydrochloride). Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
4-[(E)-dimethylaminodiazenyl]-1H-imidazole-5-carboxamide;hydrochloride (CAS 17925-90-5) is a chemical compound with the molecular formula C6H11ClN6O and a molecular weight of 218.64 g/mol. IUPAC name: 4-[(E)-dimethylaminodiazenyl]-1H-imidazole-5-carboxamide;hydrochloride. InChIKey: JTLLDOORGJVYPT-ASTDGNLGSA-N.
| Molecular formula | C6H11ClN6O |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | 4-[(E)-dimethylaminodiazenyl]-1H-imidazole-5-carboxamide;hydrochloride |
| InChIKey | JTLLDOORGJVYPT-ASTDGNLGSA-N |
| SMILES | CN(C)/N=N/C1=C(NC=N1)C(=O)N.Cl |
Computed by PubChem (NCBI)