Products 1793003-51-6
CAS 1793003-51-6 is the registry number for 3-Chloro-4-fluoro-5-(2-methylpropoxy)phenylboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
[3-chloro-4-fluoro-5-(2-methylpropoxy)phenyl]boronic acid (CAS 1793003-51-6) is a chemical compound with the molecular formula C10H13BClFO3 and a molecular weight of 246.47 g/mol. IUPAC name: [3-chloro-4-fluoro-5-(2-methylpropoxy)phenyl]boronic acid. InChIKey: JFJZOURFXZQHDI-UHFFFAOYSA-N.
| Molecular formula | C10H13BClFO3 |
|---|---|
| Molecular weight | 246.47 g/mol |
| IUPAC name | [3-chloro-4-fluoro-5-(2-methylpropoxy)phenyl]boronic acid |
| InChIKey | JFJZOURFXZQHDI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)F)OCC(C)C)(O)O |
Computed by PubChem (NCBI)