CAS 1793003-64-1 is the registry number for 3-Chloro-4,5-diisopropoxyphenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[3-chloro-4,5-di(propan-2-yloxy)phenyl]boronic acid (CAS 1793003-64-1) is a chemical compound with the molecular formula C12H18BClO4 and a molecular weight of 272.53 g/mol. IUPAC name: [3-chloro-4,5-di(propan-2-yloxy)phenyl]boronic acid. InChIKey: XLBDNXHYKMPCQU-UHFFFAOYSA-N.
| Molecular formula | C12H18BClO4 |
|---|---|
| Molecular weight | 272.53 g/mol |
| IUPAC name | [3-chloro-4,5-di(propan-2-yloxy)phenyl]boronic acid |
| InChIKey | XLBDNXHYKMPCQU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)OC(C)C)OC(C)C)(O)O |
Computed by PubChem (NCBI)