Products 1793003-66-3

CAS 1793003-66-3 is the registry number for 3-(Cyclopentyloxy)-2-fluoro-4-methoxyphenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

(3-cyclopentyloxy-2-fluoro-4-methoxyphenyl)boronic acid (CAS 1793003-66-3) is a chemical compound with the molecular formula C12H16BFO4 and a molecular weight of 254.06 g/mol. IUPAC name: (3-cyclopentyloxy-2-fluoro-4-methoxyphenyl)boronic acid. InChIKey: JHJNVXNRARWEBL-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16BFO4
Molecular weight254.06 g/mol
IUPAC name(3-cyclopentyloxy-2-fluoro-4-methoxyphenyl)boronic acid
InChIKeyJHJNVXNRARWEBL-UHFFFAOYSA-N
SMILESB(C1=C(C(=C(C=C1)OC)OC2CCCC2)F)(O)O

Computed by PubChem (NCBI)