CAS 1793003-79-8 is the registry number for 3-Butoxy-5-chloro-4-isopropoxyphenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
(3-butoxy-5-chloro-4-propan-2-yloxyphenyl)boronic acid (CAS 1793003-79-8) is a chemical compound with the molecular formula C13H20BClO4 and a molecular weight of 286.56 g/mol. IUPAC name: (3-butoxy-5-chloro-4-propan-2-yloxyphenyl)boronic acid. InChIKey: WYLGFMBTFBBDOZ-UHFFFAOYSA-N.
| Molecular formula | C13H20BClO4 |
|---|---|
| Molecular weight | 286.56 g/mol |
| IUPAC name | (3-butoxy-5-chloro-4-propan-2-yloxyphenyl)boronic acid |
| InChIKey | WYLGFMBTFBBDOZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)OC(C)C)OCCCC)(O)O |
Computed by PubChem (NCBI)