CAS 179339-70-9 appears in our catalog under these names: Cis-hexahydro-1h-thieno[3,4-c]pyrrole hydrochloride, 95%, cis-Hexahydro-1H-thieno(3,4-c)pyrrole hydrochloride, 97%, cis-hexahydro-1h-thieno(3,4-c)pyrrole hydrochloride, cis-hexahydro-1H-thieno[3,4-c]pyrrole hydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 100mg, 10g, 5g, 250mg, 500mg.
(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-thieno[3,4-c]pyrrole;hydrochloride (CAS 179339-70-9) is a chemical compound with the molecular formula C6H12ClNS and a molecular weight of 165.69 g/mol. IUPAC name: (3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-thieno[3,4-c]pyrrole;hydrochloride. InChIKey: UTFHVCNHGSHVLP-KNCHESJLSA-N.
| Molecular formula | C6H12ClNS |
|---|---|
| Molecular weight | 165.69 g/mol |
| IUPAC name | (3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-thieno[3,4-c]pyrrole;hydrochloride |
| InChIKey | UTFHVCNHGSHVLP-KNCHESJLSA-N |
| SMILES | C1[C@@H]2CSC[C@@H]2CN1.Cl |
Computed by PubChem (NCBI)