CAS 179343-23-8 appears in our catalog under these names: 6-(2,6-Dibromophenyl)pyrido(2,3-d)pyrimidine-2,7-diamine, Acetyl–CoA Carboxylase–IN–1, Acetyl-CoA Carboxylase-IN-1, 99.18%, 6-(2,6-Dibromophenyl)pyrido[2,3-d]pyrimidine-2,7-diamine, 96%, 96%. Offered by: TRC, GLPBio, MedChemExpress, Chemat. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 50mg, 10 mg, 5 mg, 25 mg.
6-(2,6-dibromophenyl)pyrido[2,3-d]pyrimidine-2,7-diamine (CAS 179343-23-8) is a chemical compound with the molecular formula C13H9Br2N5 and a molecular weight of 395.05 g/mol. IUPAC name: 6-(2,6-dibromophenyl)pyrido[2,3-d]pyrimidine-2,7-diamine. InChIKey: HGIPWJYTPOHUGK-UHFFFAOYSA-N.
| Molecular formula | C13H9Br2N5 |
|---|---|
| Molecular weight | 395.05 g/mol |
| IUPAC name | 6-(2,6-dibromophenyl)pyrido[2,3-d]pyrimidine-2,7-diamine |
| InChIKey | HGIPWJYTPOHUGK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C2=C(N=C3C(=C2)C=NC(=N3)N)N)Br |
Computed by PubChem (NCBI)