CAS 179343-52-3 is the registry number for 6–(2,6–dichlorophenyl)–2–(methylthio)pyrido(2,3–d)pyrimidin–7–amine. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
6-(2,6-dichlorophenyl)-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-amine (CAS 179343-52-3) is a chemical compound with the molecular formula C14H10Cl2N4S and a molecular weight of 337.2 g/mol. IUPAC name: 6-(2,6-dichlorophenyl)-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-amine. InChIKey: YALPLUAZYZHUDY-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2N4S |
|---|---|
| Molecular weight | 337.2 g/mol |
| IUPAC name | 6-(2,6-dichlorophenyl)-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-amine |
| InChIKey | YALPLUAZYZHUDY-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=NC(=C(C=C2C=N1)C3=C(C=CC=C3Cl)Cl)N |
Computed by PubChem (NCBI)