CAS 17938-21-5 appears in our catalog under these names: Silane,[1,1-biphenyl]-3-yltrimethyl-, 95%, (1,1'–Biphenyl)–3–yltrimethylsilane, [1,1'-Biphenyl]-3-yltrimethylsilane, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
Trimethyl-(3-phenylphenyl)silane (CAS 17938-21-5) is a chemical compound with the molecular formula C15H18Si and a molecular weight of 226.39 g/mol. IUPAC name: trimethyl-(3-phenylphenyl)silane. InChIKey: GXKHDONHBOTZRQ-UHFFFAOYSA-N.
| Molecular formula | C15H18Si |
|---|---|
| Molecular weight | 226.39 g/mol |
| IUPAC name | trimethyl-(3-phenylphenyl)silane |
| InChIKey | GXKHDONHBOTZRQ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC=CC(=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)