CAS 17940-89-5 is the registry number for 1,1,1-Trimethyl-N-(3-(triethoxysilyl)propyl)-N-(trimethylsilyl)silanamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-triethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine (CAS 17940-89-5) is a chemical compound with the molecular formula C15H39NO3Si3 and a molecular weight of 365.73 g/mol. IUPAC name: 3-triethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine. InChIKey: SLSKAIZCBJQHFI-UHFFFAOYSA-N.
| Molecular formula | C15H39NO3Si3 |
|---|---|
| Molecular weight | 365.73 g/mol |
| IUPAC name | 3-triethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine |
| InChIKey | SLSKAIZCBJQHFI-UHFFFAOYSA-N |
| SMILES | CCO[Si](CCCN([Si](C)(C)C)[Si](C)(C)C)(OCC)OCC |
Computed by PubChem (NCBI)