CAS 179411-93-9 appears in our catalog under these names: SDZ 220-581 hydrochloride, SDZ 220–581 hydrochloride, SDZ 220-581 (hydrochloride), SDZ 220-581 (hydrochloride), 99.60%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 10mg, 50mg, 10mM/1mL, 5 mg, 10 mg, 50 mg.
(2S)-2-amino-3-[3-(2-chlorophenyl)-5-(phosphonomethyl)phenyl]propanoic acid;hydrochloride (CAS 179411-93-9) is a chemical compound with the molecular formula C16H18Cl2NO5P and a molecular weight of 406.2 g/mol. IUPAC name: (2S)-2-amino-3-[3-(2-chlorophenyl)-5-(phosphonomethyl)phenyl]propanoic acid;hydrochloride. InChIKey: WSYIMHDAUSNYSF-RSAXXLAASA-N.
| Molecular formula | C16H18Cl2NO5P |
|---|---|
| Molecular weight | 406.2 g/mol |
| IUPAC name | (2S)-2-amino-3-[3-(2-chlorophenyl)-5-(phosphonomethyl)phenyl]propanoic acid;hydrochloride |
| InChIKey | WSYIMHDAUSNYSF-RSAXXLAASA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CC(=C2)CP(=O)(O)O)C[C@@H](C(=O)O)N)Cl.Cl |
Computed by PubChem (NCBI)