CAS 1794713-69-1 appears in our catalog under these names: 2-Amino-3-chloro-N-hydroxy-propanamide-15N,d3, 2–Amino–3–chloro–N–hydroxy–propanamide–15N,d3. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
2-amino-3-chloro-2,3,3-trideuterio-N-hydroxypropan(15N)amide (CAS 1794713-69-1) is a chemical compound with the molecular formula C3H7ClN2O2 and a molecular weight of 142.56 g/mol. IUPAC name: 2-amino-3-chloro-2,3,3-trideuterio-N-hydroxypropan(15N)amide. InChIKey: QCWBXJPECQJXKJ-DJFSABLTSA-N.
| Molecular formula | C3H7ClN2O2 |
|---|---|
| Molecular weight | 142.56 g/mol |
| IUPAC name | 2-amino-3-chloro-2,3,3-trideuterio-N-hydroxypropan(15N)amide |
| InChIKey | QCWBXJPECQJXKJ-DJFSABLTSA-N |
| SMILES | [2H]C([2H])(C([2H])(C(=O)[15NH]O)N)Cl |
Computed by PubChem (NCBI)