Products 1794737-28-2
CAS 1794737-28-2 appears in our catalog under these names: Butobarbital-d5 (1.0mg/ml in Acetonitrile), Butobarbital-d5. Offered by: TRC. Available pack sizes: 1x1ml, 2,5mg, 25mg.
5-butyl-5-(1,1,2,2,2-pentadeuterioethyl)-1,3-diazinane-2,4,6-trione (CAS 1794737-28-2) is a chemical compound with the molecular formula C10H16N2O3 and a molecular weight of 217.28 g/mol. IUPAC name: 5-butyl-5-(1,1,2,2,2-pentadeuterioethyl)-1,3-diazinane-2,4,6-trione. InChIKey: STDBAQMTJLUMFW-PVGOWFQYSA-N.
| Molecular formula | C10H16N2O3 |
|---|---|
| Molecular weight | 217.28 g/mol |
| IUPAC name | 5-butyl-5-(1,1,2,2,2-pentadeuterioethyl)-1,3-diazinane-2,4,6-trione |
| InChIKey | STDBAQMTJLUMFW-PVGOWFQYSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1(C(=O)NC(=O)NC1=O)CCCC |
Computed by PubChem (NCBI)