CAS 1794752-06-9 appears in our catalog under these names: Carbomethoxyhydrazide-d3, Methyl-d3 hydrazinecarboxylate. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, 25mg, 10 mg, 25 mg, 50 mg, 100 mg.
Trideuteriomethyl N-aminocarbamate (CAS 1794752-06-9) is a chemical compound with the molecular formula C2H6N2O2 and a molecular weight of 93.10 g/mol. IUPAC name: trideuteriomethyl N-aminocarbamate. InChIKey: WFJRIDQGVSJLLH-FIBGUPNXSA-N.
| Molecular formula | C2H6N2O2 |
|---|---|
| Molecular weight | 93.10 g/mol |
| IUPAC name | trideuteriomethyl N-aminocarbamate |
| InChIKey | WFJRIDQGVSJLLH-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)NN |
Computed by PubChem (NCBI)