CAS 1794752-53-6 is the registry number for 3-Methyl-1-benzyl-piperazine-d4. Offered by: TRC. Available pack sizes: 500mg, 50mg.
1-benzyl-2,2,5,5-tetradeuterio-3-methylpiperazine (CAS 1794752-53-6) is a chemical compound with the molecular formula C12H18N2 and a molecular weight of 194.31 g/mol. IUPAC name: 1-benzyl-2,2,5,5-tetradeuterio-3-methylpiperazine. InChIKey: QOFUDSPYJDXBOF-BSFGQKQYSA-N.
| Molecular formula | C12H18N2 |
|---|---|
| Molecular weight | 194.31 g/mol |
| IUPAC name | 1-benzyl-2,2,5,5-tetradeuterio-3-methylpiperazine |
| InChIKey | QOFUDSPYJDXBOF-BSFGQKQYSA-N |
| SMILES | [2H]C1(CN(C(C(N1)C)([2H])[2H])CC2=CC=CC=C2)[2H] |
Computed by PubChem (NCBI)