Products 1794752-88-7
CAS 1794752-88-7 appears in our catalog under these names: Diclofensine Impurity 1-d3, 3-Methoxy-N-methylbenzylamine-d3. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
1,1,1-trideuterio-N-[(3-methoxyphenyl)methyl]methanamine (CAS 1794752-88-7) is a chemical compound with the molecular formula C9H13NO and a molecular weight of 154.22 g/mol. IUPAC name: 1,1,1-trideuterio-N-[(3-methoxyphenyl)methyl]methanamine. InChIKey: FIFKRPFWLHBMHL-FIBGUPNXSA-N.
| Molecular formula | C9H13NO |
|---|---|
| Molecular weight | 154.22 g/mol |
| IUPAC name | 1,1,1-trideuterio-N-[(3-methoxyphenyl)methyl]methanamine |
| InChIKey | FIFKRPFWLHBMHL-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NCC1=CC(=CC=C1)OC |
Computed by PubChem (NCBI)