Products 1794753-02-8
CAS 1794753-02-8 appears in our catalog under these names: 7-Methyl-d3-1-octyl-7,8,8,8-d4 Alcohol, 98 atom % D, min 98% Chemical Purity, 7-Methyl-d3-1-octyl-7,8,8,8-d4 Alcohol. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1 mg.
7,8,8,8-tetradeuterio-7-(trideuteriomethyl)octan-1-ol (CAS 1794753-02-8) is a chemical compound with the molecular formula C9H20O and a molecular weight of 151.30 g/mol. IUPAC name: 7,8,8,8-tetradeuterio-7-(trideuteriomethyl)octan-1-ol. InChIKey: QDTDKYHPHANITQ-SCENNGIESA-N.
| Molecular formula | C9H20O |
|---|---|
| Molecular weight | 151.30 g/mol |
| IUPAC name | 7,8,8,8-tetradeuterio-7-(trideuteriomethyl)octan-1-ol |
| InChIKey | QDTDKYHPHANITQ-SCENNGIESA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(CCCCCCO)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)