Products 1794753-05-1
CAS 1794753-05-1 is the registry number for 2-Methyltryptamine-d7. Offered by: TRC. Available pack sizes: 50mg, 5mg.
2-[4,5,6,7-tetradeuterio-2-(trideuteriomethyl)-1H-indol-3-yl]ethanamine (CAS 1794753-05-1) is a chemical compound with the molecular formula C11H14N2 and a molecular weight of 181.28 g/mol. IUPAC name: 2-[4,5,6,7-tetradeuterio-2-(trideuteriomethyl)-1H-indol-3-yl]ethanamine. InChIKey: CPVSLHQIPGTMLH-AAYPNNLASA-N.
| Molecular formula | C11H14N2 |
|---|---|
| Molecular weight | 181.28 g/mol |
| IUPAC name | 2-[4,5,6,7-tetradeuterio-2-(trideuteriomethyl)-1H-indol-3-yl]ethanamine |
| InChIKey | CPVSLHQIPGTMLH-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2)C([2H])([2H])[2H])CCN)[2H])[2H] |
Computed by PubChem (NCBI)