CAS 1794754-27-0 appears in our catalog under these names: N-Methyl Metribuzin-d3, >95% (HPLC), N-Methyl Metribuzin-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 1 mg, 5 mg, 100 mg, 10 mg.
6-tert-butyl-3-methylsulfanyl-4-(trideuteriomethylamino)-1,2,4-triazin-5-one (CAS 1794754-27-0) is a chemical compound with the molecular formula C9H16N4OS and a molecular weight of 231.34 g/mol. IUPAC name: 6-tert-butyl-3-methylsulfanyl-4-(trideuteriomethylamino)-1,2,4-triazin-5-one. InChIKey: JBFWXRSTOLHNFZ-GKOSEXJESA-N.
| Molecular formula | C9H16N4OS |
|---|---|
| Molecular weight | 231.34 g/mol |
| IUPAC name | 6-tert-butyl-3-methylsulfanyl-4-(trideuteriomethylamino)-1,2,4-triazin-5-one |
| InChIKey | JBFWXRSTOLHNFZ-GKOSEXJESA-N |
| SMILES | [2H]C([2H])([2H])NN1C(=O)C(=NN=C1SC)C(C)(C)C |
Computed by PubChem (NCBI)