Products 1794754-32-7
CAS 1794754-32-7 is the registry number for N-(N-Methylpiperidinyl)methylindole-d5. Offered by: TRC. Available pack sizes: 100mg, 10mg.
1-[dideuterio-[1-(trideuteriomethyl)piperidin-2-yl]methyl]indole (CAS 1794754-32-7) is a chemical compound with the molecular formula C15H20N2 and a molecular weight of 233.36 g/mol. IUPAC name: 1-[dideuterio-[1-(trideuteriomethyl)piperidin-2-yl]methyl]indole. InChIKey: XVOUFWJFSTTZOA-JQKGTWBISA-N.
| Molecular formula | C15H20N2 |
|---|---|
| Molecular weight | 233.36 g/mol |
| IUPAC name | 1-[dideuterio-[1-(trideuteriomethyl)piperidin-2-yl]methyl]indole |
| InChIKey | XVOUFWJFSTTZOA-JQKGTWBISA-N |
| SMILES | [2H]C([2H])([2H])N1CCCCC1C([2H])([2H])N2C=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)