CAS 1794756-31-2 is the registry number for Olanzapine-d3 2-Carboxaldehyde. Offered by: TRC. Available pack sizes: 10mg, 1mg.
4-[4-(trideuteriomethyl)piperazin-1-yl]-10H-thieno[2,3-b][1,5]benzodiazepine-2-carbaldehyde (CAS 1794756-31-2) is a chemical compound with the molecular formula C17H18N4OS and a molecular weight of 329.4 g/mol. IUPAC name: 4-[4-(trideuteriomethyl)piperazin-1-yl]-10H-thieno[2,3-b][1,5]benzodiazepine-2-carbaldehyde. InChIKey: MSQVWUCKQZRTKI-FIBGUPNXSA-N.
| Molecular formula | C17H18N4OS |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 4-[4-(trideuteriomethyl)piperazin-1-yl]-10H-thieno[2,3-b][1,5]benzodiazepine-2-carbaldehyde |
| InChIKey | MSQVWUCKQZRTKI-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCN(CC1)C2=NC3=CC=CC=C3NC4=C2C=C(S4)C=O |
Computed by PubChem (NCBI)