CAS 1794756-39-0 is the registry number for N-Methyltryptamine-d3. Offered by: TRC. Available pack sizes: 50mg, 5mg.
2-(1H-indol-3-yl)-N-(trideuteriomethyl)ethanamine (CAS 1794756-39-0) is a chemical compound with the molecular formula C11H14N2 and a molecular weight of 177.26 g/mol. IUPAC name: 2-(1H-indol-3-yl)-N-(trideuteriomethyl)ethanamine. InChIKey: NCIKQJBVUNUXLW-FIBGUPNXSA-N.
| Molecular formula | C11H14N2 |
|---|---|
| Molecular weight | 177.26 g/mol |
| IUPAC name | 2-(1H-indol-3-yl)-N-(trideuteriomethyl)ethanamine |
| InChIKey | NCIKQJBVUNUXLW-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NCCC1=CNC2=CC=CC=C21 |
Computed by PubChem (NCBI)