Products 1794760-19-2
CAS 1794760-19-2 appears in our catalog under these names: Permethrin-d5 (cis/trans mixture), >95% (HPLC), Permethrin D5 (phenoxy D5), Permethrin-d5 (cis/trans mixture), Permethrin–d5, PERMETHRIN-(PHENOXY-D5), MIXTURE OF CIS. Offered by: TRC, Dr. Ehrenstorfer, TargetMol, GLPBio, Sigma-Aldrich. Available pack sizes: 10mg, 1mg, 5mg, 5 mg, 1 mg.
[3-(2,3,4,5,6-pentadeuteriophenoxy)phenyl]methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate (CAS 1794760-19-2) is a chemical compound with the molecular formula C21H20Cl2O3 and a molecular weight of 396.3 g/mol. IUPAC name: [3-(2,3,4,5,6-pentadeuteriophenoxy)phenyl]methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate. InChIKey: RLLPVAHGXHCWKJ-YQYLVRRTSA-N.
| Molecular formula | C21H20Cl2O3 |
|---|---|
| Molecular weight | 396.3 g/mol |
| IUPAC name | [3-(2,3,4,5,6-pentadeuteriophenoxy)phenyl]methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| InChIKey | RLLPVAHGXHCWKJ-YQYLVRRTSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])OC2=CC=CC(=C2)COC(=O)C3C(C3(C)C)C=C(Cl)Cl)[2H])[2H] |
Computed by PubChem (NCBI)