CAS 1794767-05-7 appears in our catalog under these names: Sodium trifluoro(1,2-13C2)acetate, 98% 98%atom%13C, Sodium Trifluoroacetate-13C2, >95% (HPLC), Sodium trifluoroacetate-13C2, 0.9988%. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg.
Sodium 2,2,2-trifluoroacetate (CAS 1794767-05-7) is a chemical compound with the molecular formula C2F3NaO2 and a molecular weight of 137.990 g/mol. IUPAC name: sodium 2,2,2-trifluoroacetate. InChIKey: UYCAUPASBSROMS-AWQJXPNKSA-M.
| Molecular formula | C2F3NaO2 |
|---|---|
| Molecular weight | 137.990 g/mol |
| IUPAC name | sodium 2,2,2-trifluoroacetate |
| InChIKey | UYCAUPASBSROMS-AWQJXPNKSA-M |
| SMILES | [13C](=O)([13C](F)(F)F)[O-].[Na+] |
Computed by PubChem (NCBI)