CAS 1794775-80-6 appears in our catalog under these names: Alcaftadine-D3, Alcaftadine–d3. Offered by: Chemat Brand, Hubei YoungXin, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
11-[1-(trideuteriomethyl)piperidin-4-ylidene]-5,6-dihydroimidazo[2,1-b][3]benzazepine-3-carbaldehyde (CAS 1794775-80-6) is a chemical compound with the molecular formula C19H21N3O and a molecular weight of 310.4 g/mol. IUPAC name: 11-[1-(trideuteriomethyl)piperidin-4-ylidene]-5,6-dihydroimidazo[2,1-b][3]benzazepine-3-carbaldehyde. InChIKey: MWTBKTRZPHJQLH-FIBGUPNXSA-N.
| Molecular formula | C19H21N3O |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 11-[1-(trideuteriomethyl)piperidin-4-ylidene]-5,6-dihydroimidazo[2,1-b][3]benzazepine-3-carbaldehyde |
| InChIKey | MWTBKTRZPHJQLH-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCC(=C2C3=CC=CC=C3CCN4C2=NC=C4C=O)CC1 |
Computed by PubChem (NCBI)