CAS 1794786-17-6 is the registry number for 4-Ethyl-5-fluoropyrimidine-d3. Offered by: TRC. Available pack sizes: 25mg.
5-fluoro-4-(2,2,2-trideuterioethyl)pyrimidine (CAS 1794786-17-6) is a chemical compound with the molecular formula C6H7FN2 and a molecular weight of 129.15 g/mol. IUPAC name: 5-fluoro-4-(2,2,2-trideuterioethyl)pyrimidine. InChIKey: AYZDRTRWCASUFO-FIBGUPNXSA-N.
| Molecular formula | C6H7FN2 |
|---|---|
| Molecular weight | 129.15 g/mol |
| IUPAC name | 5-fluoro-4-(2,2,2-trideuterioethyl)pyrimidine |
| InChIKey | AYZDRTRWCASUFO-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CC1=NC=NC=C1F |
Computed by PubChem (NCBI)