Products 1794791-32-4
CAS 1794791-32-4 appears in our catalog under these names: 2-Pyrazine-d3-carboxylic Acid, 99 atom % D, min 98% Chemical Purity, Pyrazinecarboxylic Acid-d3, >95% (HPLC), Pyrazinecarboxylic acid-d3. Offered by: CDN, TRC, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 10mg, 1mg, 10 mg, 1 mg.
3,5,6-trideuteriopyrazine-2-carboxylic acid (CAS 1794791-32-4) is a chemical compound with the molecular formula C5H4N2O2 and a molecular weight of 127.12 g/mol. IUPAC name: 3,5,6-trideuteriopyrazine-2-carboxylic acid. InChIKey: NIPZZXUFJPQHNH-CBYSEHNBSA-N.
| Molecular formula | C5H4N2O2 |
|---|---|
| Molecular weight | 127.12 g/mol |
| IUPAC name | 3,5,6-trideuteriopyrazine-2-carboxylic acid |
| InChIKey | NIPZZXUFJPQHNH-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(N=C(C(=N1)[2H])C(=O)O)[2H] |
Computed by PubChem (NCBI)