CAS 1794791-45-9 is the registry number for Sevelamer-(d5)n Hydrochloride. Offered by: TRC. Available pack sizes: 25mg.
2-[chloro(dideuterio)methyl]-2,3,3-trideuteriooxirane;prop-2-en-1-amine (CAS 1794791-45-9) is a chemical compound with the molecular formula C6H12ClNO and a molecular weight of 154.65 g/mol. IUPAC name: 2-[chloro(dideuterio)methyl]-2,3,3-trideuteriooxirane;prop-2-en-1-amine. InChIKey: ZNSIZMQNQCNRBW-LDOKZEBRSA-N.
| Molecular formula | C6H12ClNO |
|---|---|
| Molecular weight | 154.65 g/mol |
| IUPAC name | 2-[chloro(dideuterio)methyl]-2,3,3-trideuteriooxirane;prop-2-en-1-amine |
| InChIKey | ZNSIZMQNQCNRBW-LDOKZEBRSA-N |
| SMILES | [2H]C1(C(O1)([2H])C([2H])([2H])Cl)[2H].C=CCN |
Computed by PubChem (NCBI)