Products 1794811-86-1
CAS 1794811-86-1 is the registry number for Vanillyl Methyl Ketone-d5. Offered by: TRC. Available pack sizes: 100mg, 10mg.
1,1,1,3,3-pentadeuterio-3-(4-hydroxy-3-methoxyphenyl)propan-2-one (CAS 1794811-86-1) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 185.23 g/mol. IUPAC name: 1,1,1,3,3-pentadeuterio-3-(4-hydroxy-3-methoxyphenyl)propan-2-one. InChIKey: LFVCJQWZGDLHSD-RPIBLTHZSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 185.23 g/mol |
| IUPAC name | 1,1,1,3,3-pentadeuterio-3-(4-hydroxy-3-methoxyphenyl)propan-2-one |
| InChIKey | LFVCJQWZGDLHSD-RPIBLTHZSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])C1=CC(=C(C=C1)O)OC |
Computed by PubChem (NCBI)
Synonyms:
Vanillyl Methyl Ketone-d5, VanillylMethylKetone-d5