CAS 1794817-39-2 appears in our catalog under these names: Alcophosphamide-d4, Alcophosphamide–d4. Offered by: TRC, GLPBio. Available pack sizes: 10mg.
3-[amino-[bis(2-chloro-2,2-dideuterioethyl)amino]phosphoryl]oxypropan-1-ol (CAS 1794817-39-2) is a chemical compound with the molecular formula C7H17Cl2N2O3P and a molecular weight of 283.12 g/mol. IUPAC name: 3-[amino-[bis(2-chloro-2,2-dideuterioethyl)amino]phosphoryl]oxypropan-1-ol. InChIKey: BZGFIGVSVQRQBJ-RRVWJQJTSA-N.
| Molecular formula | C7H17Cl2N2O3P |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | 3-[amino-[bis(2-chloro-2,2-dideuterioethyl)amino]phosphoryl]oxypropan-1-ol |
| InChIKey | BZGFIGVSVQRQBJ-RRVWJQJTSA-N |
| SMILES | [2H]C([2H])(CN(CC([2H])([2H])Cl)P(=O)(N)OCCCO)Cl |
Computed by PubChem (NCBI)