Products 1794884-99-3
CAS 1794884-99-3 appears in our catalog under these names: 2-Amino-1-(4-methylphenyl)ethanol-d3, 2–Amino–1–(4–methylphenyl)ethanol–d3, 2-Amino-1-(p-tolyl)ethanol-d3. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 5mg, 25 mg, 2.5 mg.
2-amino-1-[4-(trideuteriomethyl)phenyl]ethanol (CAS 1794884-99-3) is a chemical compound with the molecular formula C9H13NO and a molecular weight of 154.22 g/mol. IUPAC name: 2-amino-1-[4-(trideuteriomethyl)phenyl]ethanol. InChIKey: JHBXVBYRGVHEAH-FIBGUPNXSA-N.
| Molecular formula | C9H13NO |
|---|---|
| Molecular weight | 154.22 g/mol |
| IUPAC name | 2-amino-1-[4-(trideuteriomethyl)phenyl]ethanol |
| InChIKey | JHBXVBYRGVHEAH-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC=C(C=C1)C(CN)O |
Computed by PubChem (NCBI)