CAS 1794936-94-9 appears in our catalog under these names: Ammeline-13C3 Hydrochloride, >95% (HPLC), Ammeline Hydrochloride-13C3. Offered by: TRC, MedChemExpress. Available pack sizes: 0,5mg, 5mg, 500 μg, 1 mg, 5 mg.
4,6-diamino-(2,4,6-13C3)1H-1,3,5-triazin-2-one;hydrochloride (CAS 1794936-94-9) is a chemical compound with the molecular formula C3H6ClN5O and a molecular weight of 166.54 g/mol. IUPAC name: 4,6-diamino-(2,4,6-13C3)1H-1,3,5-triazin-2-one;hydrochloride. InChIKey: MEUOOKNKMSVRLN-HCULJTSZSA-N.
| Molecular formula | C3H6ClN5O |
|---|---|
| Molecular weight | 166.54 g/mol |
| IUPAC name | 4,6-diamino-(2,4,6-13C3)1H-1,3,5-triazin-2-one;hydrochloride |
| InChIKey | MEUOOKNKMSVRLN-HCULJTSZSA-N |
| SMILES | [13C]1(=N[13C](=N[13C](=O)N1)N)N.Cl |
Computed by PubChem (NCBI)