Products 1794938-71-8
CAS 1794938-71-8 appears in our catalog under these names: Desamino Glufosinate-d3, >95% (HPLC), Desamino glufosinate-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
4-[hydroxy(trideuteriomethyl)phosphoryl]butanoic acid (CAS 1794938-71-8) is a chemical compound with the molecular formula C5H11O4P and a molecular weight of 169.13 g/mol. IUPAC name: 4-[hydroxy(trideuteriomethyl)phosphoryl]butanoic acid. InChIKey: AKAIYXRPMRQJCA-FIBGUPNXSA-N.
| Molecular formula | C5H11O4P |
|---|---|
| Molecular weight | 169.13 g/mol |
| IUPAC name | 4-[hydroxy(trideuteriomethyl)phosphoryl]butanoic acid |
| InChIKey | AKAIYXRPMRQJCA-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])P(=O)(CCCC(=O)O)O |
Computed by PubChem (NCBI)