CAS 1794940-30-9 is the registry number for 2-Methyl-2-(nitroamino)-1-propanol-d6. Offered by: TRC. Available pack sizes: 50mg.
N-[1,1,1,3,3,3-hexadeuterio-2-(hydroxymethyl)propan-2-yl]nitramide (CAS 1794940-30-9) is a chemical compound with the molecular formula C4H10N2O3 and a molecular weight of 140.17 g/mol. IUPAC name: N-[1,1,1,3,3,3-hexadeuterio-2-(hydroxymethyl)propan-2-yl]nitramide. InChIKey: WTIFXEKZEYZXMJ-WFGJKAKNSA-N.
| Molecular formula | C4H10N2O3 |
|---|---|
| Molecular weight | 140.17 g/mol |
| IUPAC name | N-[1,1,1,3,3,3-hexadeuterio-2-(hydroxymethyl)propan-2-yl]nitramide |
| InChIKey | WTIFXEKZEYZXMJ-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(CO)(C([2H])([2H])[2H])N[N+](=O)[O-] |
Computed by PubChem (NCBI)