CAS 1794941-44-8 appears in our catalog under these names: Chlortalidone-d4 (Chlorthalidone-d4), Chlorthalidone-d4, >95% (HPLC), Chlorthalidone–D4, D4-Chlorthalidone, D4-Chlorthalidone, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, GLPBio, HPC Standards, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 25mg, 5mg, 1x5mg, 1x1ml, 5 mg.
2-chloro-5-(4,5,6,7-tetradeuterio-1-hydroxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide (CAS 1794941-44-8) is a chemical compound with the molecular formula C14H11ClN2O4S and a molecular weight of 342.8 g/mol. IUPAC name: 2-chloro-5-(4,5,6,7-tetradeuterio-1-hydroxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide. InChIKey: JIVPVXMEBJLZRO-RHQRLBAQSA-N.
| Molecular formula | C14H11ClN2O4S |
|---|---|
| Molecular weight | 342.8 g/mol |
| IUPAC name | 2-chloro-5-(4,5,6,7-tetradeuterio-1-hydroxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide |
| InChIKey | JIVPVXMEBJLZRO-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=O)NC2(C3=CC(=C(C=C3)Cl)S(=O)(=O)N)O)[2H])[2H] |
Computed by PubChem (NCBI)