CAS 1794960-21-6 is the registry number for β–(N–Acetoacetylamino)ethanol–d4. Offered by: GLPBio. Available pack sizes: 1mg, 50mg.
3-oxo-N-(1,1,2,2-tetradeuterio-2-hydroxyethyl)butanamide (CAS 1794960-21-6) is a chemical compound with the molecular formula C6H11NO3 and a molecular weight of 149.18 g/mol. IUPAC name: 3-oxo-N-(1,1,2,2-tetradeuterio-2-hydroxyethyl)butanamide. InChIKey: CYLHYHWFVOHKMK-RRVWJQJTSA-N.
| Molecular formula | C6H11NO3 |
|---|---|
| Molecular weight | 149.18 g/mol |
| IUPAC name | 3-oxo-N-(1,1,2,2-tetradeuterio-2-hydroxyethyl)butanamide |
| InChIKey | CYLHYHWFVOHKMK-RRVWJQJTSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])O)NC(=O)CC(=O)C |
Computed by PubChem (NCBI)