Products 1794964-28-5
CAS 1794964-28-5 appears in our catalog under these names: p-Cyanoacetophenone-d4, 4-Acetylbenzonitrile-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 10 mg, 100 mg.
4-acetyl-2,3,5,6-tetradeuteriobenzonitrile (CAS 1794964-28-5) is a chemical compound with the molecular formula C9H7NO and a molecular weight of 149.18 g/mol. IUPAC name: 4-acetyl-2,3,5,6-tetradeuteriobenzonitrile. InChIKey: NLPHXWGWBKZSJC-QFFDRWTDSA-N.
| Molecular formula | C9H7NO |
|---|---|
| Molecular weight | 149.18 g/mol |
| IUPAC name | 4-acetyl-2,3,5,6-tetradeuteriobenzonitrile |
| InChIKey | NLPHXWGWBKZSJC-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C#N)[2H])[2H])C(=O)C)[2H] |
Computed by PubChem (NCBI)