Products 1794977-21-1
CAS 1794977-21-1 appears in our catalog under these names: Rac Alminoprofen–d3, rac Alminoprofen-d3. Offered by: GLPBio, Biosynth. Available pack sizes: 5mg, 25mg, 50mg.
3,3,3-trideuterio-2-[4-(2-methylprop-2-enylamino)phenyl]propanoic acid (CAS 1794977-21-1) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 222.30 g/mol. IUPAC name: 3,3,3-trideuterio-2-[4-(2-methylprop-2-enylamino)phenyl]propanoic acid. InChIKey: FPHLBGOJWPEVME-HPRDVNIFSA-N.
| Molecular formula | C13H17NO2 |
|---|---|
| Molecular weight | 222.30 g/mol |
| IUPAC name | 3,3,3-trideuterio-2-[4-(2-methylprop-2-enylamino)phenyl]propanoic acid |
| InChIKey | FPHLBGOJWPEVME-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC=C(C=C1)NCC(=C)C)C(=O)O |
Computed by PubChem (NCBI)