CAS 1794978-55-4 is the registry number for 4-Methylpentanal-d7. Offered by: TRC. Available pack sizes: 10mg.
4,5,5,5-tetradeuterio-4-(trideuteriomethyl)pentanal (CAS 1794978-55-4) is a chemical compound with the molecular formula C6H12O and a molecular weight of 107.20 g/mol. IUPAC name: 4,5,5,5-tetradeuterio-4-(trideuteriomethyl)pentanal. InChIKey: JGEGJYXHCFUMJF-NWOXSKRJSA-N.
| Molecular formula | C6H12O |
|---|---|
| Molecular weight | 107.20 g/mol |
| IUPAC name | 4,5,5,5-tetradeuterio-4-(trideuteriomethyl)pentanal |
| InChIKey | JGEGJYXHCFUMJF-NWOXSKRJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(CCC=O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)