CAS 1794979-08-0 appears in our catalog under these names: Pimozide-d5 (Major), >95% (HPLC), Pimozide-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
3-[1-[4,4-bis(4-fluorophenyl)butyl]-3,3,4,5,5-pentadeuteriopiperidin-4-yl]-1H-benzimidazol-2-one (CAS 1794979-08-0) is a chemical compound with the molecular formula C28H29F2N3O and a molecular weight of 466.6 g/mol. IUPAC name: 3-[1-[4,4-bis(4-fluorophenyl)butyl]-3,3,4,5,5-pentadeuteriopiperidin-4-yl]-1H-benzimidazol-2-one. InChIKey: YVUQSNJEYSNKRX-SQXKFXMRSA-N.
| Molecular formula | C28H29F2N3O |
|---|---|
| Molecular weight | 466.6 g/mol |
| IUPAC name | 3-[1-[4,4-bis(4-fluorophenyl)butyl]-3,3,4,5,5-pentadeuteriopiperidin-4-yl]-1H-benzimidazol-2-one |
| InChIKey | YVUQSNJEYSNKRX-SQXKFXMRSA-N |
| SMILES | [2H]C1(CN(CC(C1([2H])N2C3=CC=CC=C3NC2=O)([2H])[2H])CCCC(C4=CC=C(C=C4)F)C5=CC=C(C=C5)F)[2H] |
Computed by PubChem (NCBI)